ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7623-11-2 2-Chlorobutyryl chloride |
|
اسم المنتج | 2-Chlorobutyryl chloride |
الاسم بالانجليزية | 2-Chlorobutyryl chloride;2-Chlorobutyryl chloride;2-chlorobutanoyl chloride |
الصيغة الجزيئية | C4H6Cl2O |
الوزن الجزيئي الغرامي | 140.9958 |
InChI | InChI=1/C4H6Cl2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 |
إستراتيجية المساعدة القطرية | 7623-11-2 |
بنية جزيئية | ![]() |
كثافة | 1.227g/cm3 |
نقطة الغليان | 130.5°C at 760 mmHg |
معامل الإنكسار | 1.44 |
نقطة الوميض | 53.2°C |
ضغط البخار | 9.68mmHg at 25°C |
خطر المصطلحات | R34##Causes burns.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |