ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
793-25-9 2-phenyl-N'-(phenylacetyl)acetohydrazide |
|
| اسم المنتج | 2-phenyl-N'-(phenylacetyl)acetohydrazide |
| الاسم بالانجليزية | 2-phenyl-N'-(phenylacetyl)acetohydrazide;benzeneacetic acid, 2-(2-phenylacetyl)hydrazide;N'1-(2-phenylacetyl)-2-phenylethanohydrazide |
| الصيغة الجزيئية | C16H16N2O2 |
| الوزن الجزيئي الغرامي | 268.3104 |
| InChI | InChI=1/C16H16N2O2/c19-15(11-13-7-3-1-4-8-13)17-18-16(20)12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,19)(H,18,20) |
| إستراتيجية المساعدة القطرية | 793-25-9 |
| بنية جزيئية | ![]() |
| كثافة | 1.177g/cm3 |
| نقطة الغليان | 542.3°C at 760 mmHg |
| معامل الإنكسار | 1.589 |
| نقطة الوميض | 214.9°C |
| ضغط البخار | 8.02E-12mmHg at 25°C |
| MSDS | |