ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97480-60-9 3,5-Dimethylphenylthiourea |
|
| اسم المنتج | 3,5-Dimethylphenylthiourea |
| الاسم بالانجليزية | 3,5-Dimethylphenylthiourea;1-(3,5-dimethylphenyl)thiourea |
| الصيغة الجزيئية | C9H12N2S |
| الوزن الجزيئي الغرامي | 180.27 |
| InChI | InChI=1/C9H12N2S/c1-6-3-7(2)5-8(4-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
| إستراتيجية المساعدة القطرية | 97480-60-9 |
| بنية جزيئية | ![]() |
| كثافة | 1.2g/cm3 |
| نقطة الغليان | 293.9°C at 760 mmHg |
| معامل الإنكسار | 1.674 |
| نقطة الوميض | 131.5°C |
| ضغط البخار | 0.00168mmHg at 25°C |
| خطر المصطلحات | R25##Toxic if swallowed.:; |
| شروط الأمن | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |