ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
10401-11-3 3-Hydroxyphenylacetylene |
|
Ürün Adı | 3-Hydroxyphenylacetylene |
ingilizce adı | 3-Hydroxyphenylacetylene;3-Ethynylphenol |
Moleküler Formülü | C8H6O |
Molekül Ağırlığı | 118.1326 |
InChI | InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
CAS kayıt numarası | 10401-11-3 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.12g/cm3 |
Kaynama noktası | 230.9°C at 760 mmHg |
Kırılma indisi | 1.589 |
Alevlenme noktası | 106.1°C |
Buhar basıncı | 0.0424mmHg at 25°C |
Risk Kodları | R36/38##Irritating to eyes and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |