ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207986-25-2 alpha-Bromo-4-(diethylamino)acetophenone |
|
Ürün Adı | alpha-Bromo-4-(diethylamino)acetophenone |
ingilizce adı | alpha-Bromo-4-(diethylamino)acetophenone;4-(Diethylamino)phenacyl bromide;2-bromo-1-[4-(diethylamino)phenyl]ethanone |
Moleküler Formülü | C12H16BrNO |
Molekül Ağırlığı | 270.1655 |
InChI | InChI=1/C12H16BrNO/c1-3-14(4-2)11-7-5-10(6-8-11)12(15)9-13/h5-8H,3-4,9H2,1-2H3 |
CAS kayıt numarası | 207986-25-2 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.316g/cm3 |
Kaynama noktası | 357.7°C at 760 mmHg |
Kırılma indisi | 1.572 |
Alevlenme noktası | 170.1°C |
Buhar basıncı | 2.69E-05mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |