ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2423-71-4 2,6-Dimethyl-4-nitrophenol |
|
Ürün Adı | 2,6-Dimethyl-4-nitrophenol |
ingilizce adı | 2,6-Dimethyl-4-nitrophenol;4-Nitro-2,6-xylenol;2,6-dimethyl-4-nitrophenolate |
Moleküler Formülü | C8H8NO3 |
Molekül Ağırlığı | 166.1546 |
InChI | InChI=1/C8H9NO3/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4,10H,1-2H3/p-1 |
CAS kayıt numarası | 2423-71-4 |
EINECS | 219-353-9 |
Moleküler Yapısı | ![]() |
Ergime noktası | 164℃ |
Kaynama noktası | 322.8°C at 760 mmHg |
Alevlenme noktası | 145.3°C |
Buhar basıncı | 0.000145mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.||R41##Risks of serious damage to eyes.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |