ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
32025-65-3 3-Methoxyphenylglyoxal hydrate |
|
Ürün Adı | 3-Methoxyphenylglyoxal hydrate |
ingilizce adı | 3-Methoxyphenylglyoxal hydrate;3-Methoxyphenylglyoxal;AI3-25049;meta-Methoxyphenylglyoxal;Benzeneacetaldehyde, 3-methoxy-alpha-oxo-, hemihydrate;(3-methoxyphenyl)(oxo)acetaldehyde |
Moleküler Formülü | C9H8O3 |
Molekül Ağırlığı | 164.158 |
InChI | InChI=1/C9H8O3/c1-12-8-4-2-3-7(5-8)9(11)6-10/h2-6H,1H3 |
CAS kayıt numarası | 32025-65-3 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.153g/cm3 |
Kaynama noktası | 264.3°C at 760 mmHg |
Kırılma indisi | 1.518 |
Alevlenme noktası | 113.5°C |
Buhar basıncı | 0.00981mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |