ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
32065-63-7 1-(2,5-dimethoxyphenyl)-3-phenylthiourea |
|
| Ürün Adı | 1-(2,5-dimethoxyphenyl)-3-phenylthiourea |
| ingilizce adı | 1-(2,5-dimethoxyphenyl)-3-phenylthiourea;thiourea, N-(2,5-dimethoxyphenyl)-N'-phenyl- |
| Moleküler Formülü | C15H16N2O2S |
| Molekül Ağırlığı | 288.3647 |
| InChI | InChI=1/C15H16N2O2S/c1-18-12-8-9-14(19-2)13(10-12)17-15(20)16-11-6-4-3-5-7-11/h3-10H,1-2H3,(H2,16,17,20) |
| CAS kayıt numarası | 32065-63-7 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.277g/cm3 |
| Kaynama noktası | 420.9°C at 760 mmHg |
| Kırılma indisi | 1.683 |
| Alevlenme noktası | 208.4°C |
| Buhar basıncı | 2.71E-07mmHg at 25°C |
| MSDS | |