ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
329-79-3 4-Fluoroacetophenone oxime |
|
| Ürün Adı | 4-Fluoroacetophenone oxime |
| ingilizce adı | 4-Fluoroacetophenone oxime;Acetophenone, 4'-fluoro-, oxime;4'-Fluoroacetophenone oxime;BRN 2086063;NSC 154663;Ethanone, 1-(4-fluorophenyl)-, oxime (9CI);1-(4-fluorophenyl)-N-hydroxyethanimine;(1E)-1-(4-fluorophenyl)ethanone oxime;(1Z)-1-(4-fluorophenyl)ethanone oxime |
| Moleküler Formülü | C8H8FNO |
| Molekül Ağırlığı | 153.1536 |
| InChI | InChI=1/C8H8FNO/c1-6(10-11)7-2-4-8(9)5-3-7/h2-5,11H,1H3/b10-6- |
| CAS kayıt numarası | 329-79-3 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.12g/cm3 |
| Ergime noktası | 72℃ |
| Kaynama noktası | 239.8°C at 760 mmHg |
| Kırılma indisi | 1.503 |
| Alevlenme noktası | 98.8°C |
| Buhar basıncı | 0.0214mmHg at 25°C |
| Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |