ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3635-74-3 4-(acetamido)benzoic acid, compound with 2-(dimethylamino)ethanol (1:1) | 
    |
| Ürün Adı | 4-(acetamido)benzoic acid, compound with 2-(dimethylamino)ethanol (1:1) | 
| ingilizce adı | 4-(acetamido)benzoic acid, compound with 2-(dimethylamino)ethanol (1:1);Deanol acetamidobenzoate;2-(Dimethylamino)ethanol p-acetylaminobenzoate;2-Dimethylaminoethanol p-acetamidobenzoate;4-(Acetylamino)benzoic acid compd. with 2-(dimethylamino)ethanol (1:1);Cervoxan;DMAE p-acetamidobenzoate;Deaner;Deanol p-acetamidobenzoate;Diforene;Elevan;Ethanol, 2-(dimethylamino)-, 4-(acetylamino)benzoate (salt);Ethanol, 2-(dimethylamino)-, compd. with p-acetamidobenzoic acid (1:1);Ethanol, 2-(dimethylamino)-, p-acetamidobenzoate (salt);NSC 97399;Nervoton;UNII-JSQ17GL1CN;2-(Dimethylamino)ethanol p-acetamidobenzoate;4-(Acetamido)benzoic acid, compound with 2-(dimethylamino)ethanol (1:1);Benzoic acid, 4-(acetylamino)-, compd. with 2-(dimethylamino)ethanol (1:1) (9CI);Benzoic acid, p-acetamido-, compd. with 2-(dimethylamino)ethanol (1:1) (8CI);Ethanol, 2-(dimethylamino)-, p-acetamidobenzoate;4-(acetylamino)benzoic acid - 2-(dimethylamino)ethanol (1:1) | 
| Moleküler Formülü | C13H20N2O4 | 
| Molekül Ağırlığı | 268.3089 | 
| InChI | InChI=1/C9H9NO3.C4H11NO/c1-6(11)10-8-4-2-7(3-5-8)9(12)13;1-5(2)3-4-6/h2-5H,1H3,(H,10,11)(H,12,13);6H,3-4H2,1-2H3 | 
| CAS kayıt numarası | 3635-74-3 | 
| EINECS | 222-858-7 | 
| Moleküler Yapısı | ![]()  | 
    
| Kaynama noktası | 439.6°C at 760 mmHg | 
| Alevlenme noktası | 219.7°C | 
| Buhar basıncı | 1.66E-08mmHg at 25°C | 
| MSDS | |