ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
36847-94-6 N-(2-Methoxyphenyl)maleamic acid |
|
Ürün Adı | N-(2-Methoxyphenyl)maleamic acid |
ingilizce adı | N-(2-Methoxyphenyl)maleamic acid;(2Z)-4-[(2-methoxyphenyl)amino]-4-oxobut-2-enoic acid;(2E)-4-[(2-methoxyphenyl)amino]-4-oxobut-2-enoate |
Moleküler Formülü | C11H10NO4 |
Molekül Ağırlığı | 220.2019 |
InChI | InChI=1/C11H11NO4/c1-16-9-5-3-2-4-8(9)12-10(13)6-7-11(14)15/h2-7H,1H3,(H,12,13)(H,14,15)/p-1/b7-6+ |
CAS kayıt numarası | 36847-94-6 |
Moleküler Yapısı | ![]() |
Kaynama noktası | 468.9°C at 760 mmHg |
Alevlenme noktası | 237.4°C |
Buhar basıncı | 1.35E-09mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |