ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
37989-92-7 1- (2'-floro [1,1'-bifenil] -4-il) propan-1-on |
|
Ürün Adı | 1- (2'-floro [1,1'-bifenil] -4-il) propan-1-on |
Eş anlamlı | 1- (2'-florobifenil-4-il) propan-1-on; |
ingilizce adı | 1-(2'-fluoro[1,1'-biphenyl]-4-yl)propan-1-one;1-(2'-fluorobiphenyl-4-yl)propan-1-one |
Moleküler Formülü | C15H13FO |
Molekül Ağırlığı | 228.2615 |
InChI | InChI=1/C15H13FO/c1-2-15(17)12-9-7-11(8-10-12)13-5-3-4-6-14(13)16/h3-10H,2H2,1H3 |
CAS kayıt numarası | 37989-92-7 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.102g/cm3 |
Kaynama noktası | 334.1°C at 760 mmHg |
Kırılma indisi | 1.545 |
Alevlenme noktası | 138.5°C |
Buhar basıncı | 0.000131mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |