ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
418789-26-1 1-(1,3-benzodioxol-5-yl)-N-(3-fluorobenzyl)methanamine |
|
| Ürün Adı | 1-(1,3-benzodioxol-5-yl)-N-(3-fluorobenzyl)methanamine |
| ingilizce adı | 1-(1,3-benzodioxol-5-yl)-N-(3-fluorobenzyl)methanamine;1-(1,3-Benzodioxol-5-yl)-N-(3-fluorobenzyl)methanamine;1,3-Benzodioxole-5-methanamine, N-[(3-fluorophenyl)methyl]-;Benzo[1,3]dioxol-5-ylmethyl-(3-fluoro-benzyl)-amine |
| Moleküler Formülü | C15H14FNO2 |
| Molekül Ağırlığı | 259.2756 |
| InChI | InChI=1/C15H14FNO2/c16-13-3-1-2-11(6-13)8-17-9-12-4-5-14-15(7-12)19-10-18-14/h1-7,17H,8-10H2 |
| CAS kayıt numarası | 418789-26-1 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.251g/cm3 |
| Kaynama noktası | 364.6°C at 760 mmHg |
| Kırılma indisi | 1.591 |
| Alevlenme noktası | 174.3°C |
| Buhar basıncı | 1.66E-05mmHg at 25°C |
| MSDS | |