ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4463-33-6 2,3-Dimethoxytoluene |
|
| Ürün Adı | 2,3-Dimethoxytoluene |
| ingilizce adı | 2,3-Dimethoxytoluene;3-Methylveratrole;1,2-dimethoxy-3-methylbenzene |
| Moleküler Formülü | C9H12O2 |
| Molekül Ağırlığı | 152.1904 |
| InChI | InChI=1/C9H12O2/c1-7-5-4-6-8(10-2)9(7)11-3/h4-6H,1-3H3 |
| CAS kayıt numarası | 4463-33-6 |
| EINECS | 224-726-4 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 0.99g/cm3 |
| Kaynama noktası | 201.4°C at 760 mmHg |
| Kırılma indisi | 1.489 |
| Alevlenme noktası | 67.6°C |
| Buhar basıncı | 0.438mmHg at 25°C |
| Risk Kodları | R36/38##Irritating to eyes and skin.:; |
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |