ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
447-31-4 Desyl chloride |
|
| Ürün Adı | Desyl chloride |
| ingilizce adı | Desyl chloride;alpha-Chloro-alpha-phenylacetophenone;alpha-chlorodeoxybenzoin;2-chloro-1,2-diphenylethanone;(2R)-2-chloro-1,2-diphenylethanone;(2S)-2-chloro-1,2-diphenylethanone |
| Moleküler Formülü | C14H11ClO |
| Molekül Ağırlığı | 230.6895 |
| InChI | InChI=1/C14H11ClO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H/t13-/m0/s1 |
| CAS kayıt numarası | 447-31-4 |
| EINECS | 207-181-7 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.19g/cm3 |
| Ergime noktası | 65-69℃ |
| Kaynama noktası | 345.5°C at 760 mmHg |
| Kırılma indisi | 1.592 |
| Alevlenme noktası | 190.4°C |
| Buhar basıncı | 6.14E-05mmHg at 25°C |
| Tehlike Sembolleri | |
| Risk Kodları | R20/21##Harmful by inhalation and in contact with skin.||R37##Irritating to respiratory system.:; |
| Güvenlik Açıklaması | S22##Do not inhale dust.||S24##Avoid contact with skin.:; |
| MSDS | |