ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4653-08-1 3-(2-thenoyl)propionic acid |
|
Ürün Adı | 3-(2-thenoyl)propionic acid |
ingilizce adı | 3-(2-thenoyl)propionic acid;4-Oxo-4-(2-thienyl)butyric acid;4-oxo-4-(thiophen-2-yl)butanoic acid;4-oxo-4-thiophen-2-ylbutanoate |
Moleküler Formülü | C8H7O3S |
Molekül Ağırlığı | 183.2049 |
InChI | InChI=1/C8H8O3S/c9-6(3-4-8(10)11)7-2-1-5-12-7/h1-2,5H,3-4H2,(H,10,11)/p-1 |
CAS kayıt numarası | 4653-08-1 |
EINECS | 225-089-5 |
Moleküler Yapısı | ![]() |
Kaynama noktası | 400.5°C at 760 mmHg |
Alevlenme noktası | 196°C |
Buhar basıncı | 3.93E-07mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |