ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
497-03-0 2-methyl-2-butenal |
|
Ürün Adı | 2-methyl-2-butenal |
ingilizce adı | 2-methyl-2-butenal;Methylbutenal;tiglaldehyde;guaiol;2-Methylcrotonaldehyde~Tiglic aldehyde |
Moleküler Formülü | C5H8O |
Molekül Ağırlığı | 84.11 |
InChI | InChI=1/C5H8O/c1-3-5(2)4-6/h3-4H,1-2H3/b5-3+ |
CAS kayıt numarası | 497-03-0 |
EINECS | 207-833-0 |
Moleküler Yapısı | ![]() |
Yoğunluk | 0.871 |
Kaynama noktası | 115-118℃ (752 torr) |
Kırılma indisi | 1.447 |
Alevlenme noktası | 18℃ |
Tehlike Sembolleri | |
Risk Kodları | R11##Highly flammable.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |