ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5412-69-1 5-Diethylamino-2-pentanol |
|
Ürün Adı | 5-Diethylamino-2-pentanol |
ingilizce adı | 5-Diethylamino-2-pentanol;5-Diethylaminopentan-2-ol;(4S)-N,N-diethyl-4-hydroxypentan-1-aminium;(4R)-N,N-diethyl-4-hydroxypentan-1-aminium |
Moleküler Formülü | C9H22NO |
Molekül Ağırlığı | 160.2765 |
InChI | InChI=1/C9H21NO/c1-4-10(5-2)8-6-7-9(3)11/h9,11H,4-8H2,1-3H3/p+1/t9-/m1/s1 |
CAS kayıt numarası | 5412-69-1 |
EINECS | 226-497-6 |
Moleküler Yapısı | ![]() |
Kaynama noktası | 218.6°C at 760 mmHg |
Alevlenme noktası | 70.2°C |
Buhar basıncı | 0.0264mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |