Chemindex > 56107-02-9
TR ▼
56107-02-9 4-Chloro-3-nitrobenzophenone |
|
| Ürün Adı | 4-Chloro-3-nitrobenzophenone |
| ingilizce adı | 4-Chloro-3-nitrobenzophenone;(4-Chloro-3-nitrophenyl)phenylmethanone |
| Moleküler Formülü | C13H8ClNO3 |
| Molekül Ağırlığı | 261.6605 |
| InChI | InChI=1/C13H8ClNO3/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9/h1-8H |
| CAS kayıt numarası | 56107-02-9 |
| EINECS | 259-995-7 |
| Moleküler Yapısı |  |
| Yoğunluk | 1.367g/cm3 |
| Ergime noktası | 101-107℃ |
| Kaynama noktası | 386.5°C at 760 mmHg |
| Kırılma indisi | 1.623 |
| Alevlenme noktası | 203.4°C |
| Buhar basıncı | 3.53E-06mmHg at 25°C |
| Tehlike Sembolleri |  Xn##Harmful:; |
| Risk Kodları | R20/21##Harmful by inhalation and in contact with skin.:; |
| Güvenlik Açıklaması | S22##Do not inhale dust.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Çin'den kimyasal tedarik etmeyi planlıyorsanız, sadece ChemNet alışveriş merkezine gidin, sizin için Çinli üreticilerden en son ve rekabetçi fiyatı alacağız.Lütfen ziyaret edin
ChemNet Mall
Chemical CAS Veritabanı Hizmeti, ChemIndex.com tarafından sağlanmaktadır. 