ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56396-38-4 N~2~-[(4-chlorophenyl)carbonyl]-N~5~-(phenylcarbonyl)-L-ornithine |
|
| Ürün Adı | N~2~-[(4-chlorophenyl)carbonyl]-N~5~-(phenylcarbonyl)-L-ornithine |
| ingilizce adı | N~2~-[(4-chlorophenyl)carbonyl]-N~5~-(phenylcarbonyl)-L-ornithine; |
| Moleküler Formülü | C19H19ClN2O4 |
| Molekül Ağırlığı | 374.8182 |
| InChI | InChI=1/C19H19ClN2O4/c20-15-10-8-14(9-11-15)18(24)22-16(19(25)26)7-4-12-21-17(23)13-5-2-1-3-6-13/h1-3,5-6,8-11,16H,4,7,12H2,(H,21,23)(H,22,24)(H,25,26)/t16-/m0/s1 |
| CAS kayıt numarası | 56396-38-4 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.303g/cm3 |
| Kaynama noktası | 697°C at 760 mmHg |
| Kırılma indisi | 1.597 |
| Alevlenme noktası | 375.3°C |
| Buhar basıncı | 2.17E-20mmHg at 25°C |
| MSDS | |