ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
589-98-0 3-Octanol |
|
Ürün Adı | 3-Octanol |
ingilizce adı | 3-Octanol;DL-3-Octanol;ethylpentylcarbinol;n-Amyl ethyl carbinol;Ethyl n-pentyl carbinol;(3S)-octan-3-ol;(±)-octan-3-ol;(3R)-octan-3-ol |
Moleküler Formülü | C8H18O |
Molekül Ağırlığı | 130.2279 |
InChI | InChI=1/C8H18O/c1-3-5-6-7-8(9)4-2/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
CAS kayıt numarası | 589-98-0;20296-29-1 |
EINECS | 209-667-4 |
Moleküler Yapısı | ![]() |
Yoğunluk | 0.821g/cm3 |
Ergime noktası | -45℃ |
Kaynama noktası | 169°C at 760 mmHg |
Kırılma indisi | 1.426 |
Alevlenme noktası | 65.6°C |
Buhar basıncı | 0.512mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |