ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
60-93-5 quinine dihydrochloride |
|
| Ürün Adı | quinine dihydrochloride |
| ingilizce adı | quinine dihydrochloride;Quinine Dihydochloride;(8alpha,9R)-6'-methoxycinchonan-9-ol dihydrochloride |
| Moleküler Formülü | C20H26Cl2N2O2 |
| Molekül Ağırlığı | 397.3386 |
| InChI | InChI=1/C20H24N2O2.2ClH/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;2*1H/t13-,14-,19-,20+;;/m0../s1 |
| CAS kayıt numarası | 60-93-5 |
| EINECS | 200-493-4 |
| Moleküler Yapısı | ![]() |
| Kaynama noktası | 495.9°C at 760 mmHg |
| Alevlenme noktası | 253.7°C |
| Buhar basıncı | 1.19E-10mmHg at 25°C |
| Risk Kodları | R22##Harmful if swallowed.||R42/43##May cause sensitization by inhalation and skin contact.:; |
| Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |