ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
618-56-4 3,5-Diaminobenzoic acid dihydrochloride |
|
| Ürün Adı | 3,5-Diaminobenzoic acid dihydrochloride |
| ingilizce adı | 3,5-Diaminobenzoic acid dihydrochloride;Benzoic acid, 3,5-diamino-, hydrochloride (1:2);AI3-51087;NSC 57806;Benzoic acid, 3,5-diamino-, dihydrochloride |
| Moleküler Formülü | C7H8N2O2.2HCl |
| Molekül Ağırlığı | 225.07 |
| InChI | InChI=1/C7H8N2O2.2ClH/c8-5-1-4(7(10)11)2-6(9)3-5;;/h1-3H,8-9H2,(H,10,11);2*1H |
| CAS kayıt numarası | 618-56-4 |
| EINECS | 210-556-8 |
| Moleküler Yapısı | ![]() |
| Ergime noktası | 300℃ |
| Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |