ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
66399-30-2 (S)-1-(4-Fluorophenyl)ethylamine |
|
Ürün Adı | (S)-1-(4-Fluorophenyl)ethylamine |
ingilizce adı | (S)-1-(4-Fluorophenyl)ethylamine;(S)-(-)-1-(4-Fluorophenyl)ethylamine;(S)-4-Fluoro-alpha-methylbenzylamine;1-bromo-2,3,4-trichloro-1,1,2-trifluorobutane;(1S)-1-(4-fluorophenyl)ethanamine |
Moleküler Formülü | C8H10FN |
Molekül Ağırlığı | 139.1701 |
InChI | InChI=1/C8H10FN/c1-6(10)7-2-4-8(9)5-3-7/h2-6H,10H2,1H3/t6-/m0/s1 |
CAS kayıt numarası | 66399-30-2 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.063g/cm3 |
Kaynama noktası | 185.4°C at 760 mmHg |
Kırılma indisi | 1.512 |
Alevlenme noktası | 74°C |
Buhar basıncı | 0.698mmHg at 25°C |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |