ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
70-69-9 4'-Aminopropiophenone |
|
| Ürün Adı | 4'-Aminopropiophenone |
| ingilizce adı | 4'-Aminopropiophenone;4-Aminopropiophenone;para-Aminopropiophenone;p-Aminopropiophenone |
| Moleküler Formülü | C9H11NO |
| Molekül Ağırlığı | 149.1897 |
| InChI | InChI=1/C9H11NO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| CAS kayıt numarası | 70-69-9 |
| EINECS | 200-742-7 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.067g/cm3 |
| Ergime noktası | 137-143℃ |
| Kaynama noktası | 305.8°C at 760 mmHg |
| Kırılma indisi | 1.559 |
| Alevlenme noktası | 138.7°C |
| Buhar basıncı | 0.000805mmHg at 25°C |
| Tehlike Sembolleri | |
| Risk Kodları | R25##Toxic if swallowed.:; |
| Güvenlik Açıklaması | S28A##After contact with skin, wash immediately with plenty of water.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |