ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
701-70-2 Alpha-Ethylphenethyl alcohol |
|
| Ürün Adı | Alpha-Ethylphenethyl alcohol |
| ingilizce adı | Alpha-Ethylphenethyl alcohol;1-Phenyl-2-butanol;1-phenylbutan-2-ol;(2S)-1-phenylbutan-2-ol;(2R)-1-phenylbutan-2-ol |
| Moleküler Formülü | C10H14O |
| Molekül Ağırlığı | 150.2176 |
| InChI | InChI=1/C10H14O/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-/m1/s1 |
| CAS kayıt numarası | 701-70-2 |
| EINECS | 211-858-2 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 0.98g/cm3 |
| Kaynama noktası | 226.6°C at 760 mmHg |
| Kırılma indisi | 1.52 |
| Alevlenme noktası | 100°C |
| Buhar basıncı | 0.0459mmHg at 25°C |
| Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |