ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71642-16-5 3-Methyl-2,4,6-tribromoaniline |
|
Ürün Adı | 3-Methyl-2,4,6-tribromoaniline |
ingilizce adı | 3-Methyl-2,4,6-tribromoaniline;2,4,6-Tribromo-3-methylaniline~2,4,6-Tribromo-m-toluidine;2,4,6-Tribromo-m-toluidine;2,4,6-tribromo-3-methylaniline |
Moleküler Formülü | C7H6Br3N |
Molekül Ağırlığı | 343.8412 |
InChI | InChI=1/C7H6Br3N/c1-3-4(8)2-5(9)7(11)6(3)10/h2H,11H2,1H3 |
CAS kayıt numarası | 71642-16-5 |
Moleküler Yapısı | ![]() |
Yoğunluk | 2.196g/cm3 |
Ergime noktası | 101-102℃ |
Kaynama noktası | 314.1°C at 760 mmHg |
Kırılma indisi | 1.668 |
Alevlenme noktası | 143.8°C |
Buhar basıncı | 0.000475mmHg at 25°C |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |