ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
814-68-6 Acryloyl chloride |
|
| Ürün Adı | Acryloyl chloride |
| ingilizce adı | Acryloyl chloride;Propenoyl chloride;Acrylyl chloride;prop-2-enoyl chloride;Acyloyl chloride |
| Moleküler Formülü | C3H3OCl |
| Molekül Ağırlığı | 90.5083 |
| InChI | InChI=1/C3H3ClO/c1-2-3(4)5/h2H,1H2 |
| CAS kayıt numarası | 814-68-6 |
| EINECS | 212-399-0 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.108g/cm3 |
| Kaynama noktası | 75.5°C at 760 mmHg |
| Kırılma indisi | 1.417 |
| Alevlenme noktası | 16.1°C |
| Buhar basıncı | 105mmHg at 25°C |
| Tehlike Sembolleri | |
| Risk Kodları | R11##Highly flammable.||R34##Causes burns.:; |
| Güvenlik Açıklaması | S16##Keep away from sources of ignition - No smoking.||S30##Never add water to this product.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |