ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97480-60-9 3,5-Dimethylphenylthiourea | 
    |
| Ürün Adı | 3,5-Dimethylphenylthiourea | 
| ingilizce adı | 3,5-Dimethylphenylthiourea;1-(3,5-dimethylphenyl)thiourea | 
| Moleküler Formülü | C9H12N2S | 
| Molekül Ağırlığı | 180.27 | 
| InChI | InChI=1/C9H12N2S/c1-6-3-7(2)5-8(4-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) | 
| CAS kayıt numarası | 97480-60-9 | 
| Moleküler Yapısı | ![]()  | 
    
| Yoğunluk | 1.2g/cm3 | 
| Kaynama noktası | 293.9°C at 760 mmHg | 
| Kırılma indisi | 1.674 | 
| Alevlenme noktası | 131.5°C | 
| Buhar basıncı | 0.00168mmHg at 25°C | 
| Risk Kodları | R25##Toxic if swallowed.:; | 
    
| Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
    
| MSDS | |