ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97480-60-9 3,5-Dimethylphenylthiourea |
|
Ürün Adı | 3,5-Dimethylphenylthiourea |
ingilizce adı | 3,5-Dimethylphenylthiourea;1-(3,5-dimethylphenyl)thiourea |
Moleküler Formülü | C9H12N2S |
Molekül Ağırlığı | 180.27 |
InChI | InChI=1/C9H12N2S/c1-6-3-7(2)5-8(4-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
CAS kayıt numarası | 97480-60-9 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.2g/cm3 |
Kaynama noktası | 293.9°C at 760 mmHg |
Kırılma indisi | 1.674 |
Alevlenme noktası | 131.5°C |
Buhar basıncı | 0.00168mmHg at 25°C |
Risk Kodları | R25##Toxic if swallowed.:; |
Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |