ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
10-15-1 (1aR,3S,4Z,5aR,8aR,9R,10aR)-3-(acetyloxy)-4,10a-dimethyl-8-methylidene-7-oxo-1a,2,3,5a,7,8,8a,9,10,10a-decahydrooxireno[5,6]cyclodeca[1,2-b]furan-9-yl 2-methylpropanoate |
|
| Chemical Name | (1aR,3S,4Z,5aR,8aR,9R,10aR)-3-(acetyloxy)-4,10a-dimethyl-8-methylidene-7-oxo-1a,2,3,5a,7,8,8a,9,10,10a-decahydrooxireno[5,6]cyclodeca[1,2-b]furan-9-yl 2-methylpropanoate |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.4428 |
| InChl | InChI=1/C21H28O7/c1-10(2)19(23)27-16-9-21(6)17(28-21)8-14(25-13(5)22)11(3)7-15-18(16)12(4)20(24)26-15/h7,10,14-18H,4,8-9H2,1-3,5-6H3/b11-7-/t14-,15+,16+,17+,18-,21+/m0/s1 |
| CAS Registry Number | 10-15-1;54153-71-8 |
| Molecular Structure | ![]() |
| Density | 1.2g/cm3 |
| Boiling Point | 513.3°C at 760 mmHg |
| Refractive Index | 1.525 |
| Flash Point | 222.6°C |
| Vapour Pressur | 1.19E-10mmHg at 25°C |
| MSDS | |