ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
126740-44-1 N-(7-methyl-1,2,3,4-tetrahydroacridin-9-yl)-2-piperidin-1-ylacetamide |
|
| Chemical Name | N-(7-methyl-1,2,3,4-tetrahydroacridin-9-yl)-2-piperidin-1-ylacetamide |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.4586 |
| InChl | InChI=1/C21H27N3O/c1-15-9-10-19-17(13-15)21(16-7-3-4-8-18(16)22-19)23-20(25)14-24-11-5-2-6-12-24/h9-10,13H,2-8,11-12,14H2,1H3,(H,22,23,25) |
| CAS Registry Number | 126740-44-1 |
| Molecular Structure | ![]() |
| Density | 1.177g/cm3 |
| Boiling Point | 562.7°C at 760 mmHg |
| Refractive Index | 1.635 |
| Flash Point | 294.1°C |
| Vapour Pressur | 1.09E-12mmHg at 25°C |
| MSDS | |