ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
14088-96-1 1-(3-BROMOPHENYL)TETRAHYDRO-2H-IMIDAZOL-2-ONE |
|
| Chemical Name | 1-(3-BROMOPHENYL)TETRAHYDRO-2H-IMIDAZOL-2-ONE |
| Synonyms | 1-(3-Bromophenyl)imidazolidin-2-one |
| Molecular Formula | C9H9BrN2O |
| Molecular Weight | 241.0846 |
| InChl | InChI=1/C9H9BrN2O/c10-7-2-1-3-8(6-7)12-5-4-11-9(12)13/h1-3,6H,4-5H2,(H,11,13) |
| CAS Registry Number | 14088-96-1 |
| Molecular Structure | ![]() |
| Density | 1.579g/cm3 |
| Melting Point | 132-135℃ |
| Refractive Index | 1.611 |
| Hazard Symbols | |
| MSDS | |