ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
203522-12-7 1-N-Cbz-4-Methylpiperidine-4-carboxylic acid |
|
| Chemical Name | 1-N-Cbz-4-Methylpiperidine-4-carboxylic acid |
| Synonyms | 4-Methylpiperidine-1,4-dicarboxylic acid 1-(phenylmethyl) ester;1-[(benzyloxy)carbonyl]-4-methylpiperidine-4-carboxylic acid;1-N-Cbz-4-Methyl-Piperidine-4-Carboxylic Acid |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.3157 |
| InChl | InChI=1/C15H19NO4/c1-15(13(17)18)7-9-16(10-8-15)14(19)20-11-12-5-3-2-4-6-12/h2-6H,7-11H2,1H3,(H,17,18) |
| CAS Registry Number | 203522-12-7 |
| Molecular Structure | ![]() |
| Density | 1.224g/cm3 |
| Boiling Point | 440.3°C at 760 mmHg |
| Refractive Index | 1.555 |
| Flash Point | 220.1°C |
| Vapour Pressur | 1.57E-08mmHg at 25°C |
| MSDS | |