ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26482-11-1 4-{4-[2-(3,4-dimethoxyphenyl)ethyl]-5-methyl-1H-imidazol-2-yl}butyl acetate |
|
| Chemical Name | 4-{4-[2-(3,4-dimethoxyphenyl)ethyl]-5-methyl-1H-imidazol-2-yl}butyl acetate |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.4473 |
| InChl | InChI=1/C20H28N2O4/c1-14-17(22-20(21-14)7-5-6-12-26-15(2)23)10-8-16-9-11-18(24-3)19(13-16)25-4/h9,11,13H,5-8,10,12H2,1-4H3,(H,21,22) |
| CAS Registry Number | 26482-11-1 |
| Molecular Structure | ![]() |
| Density | 1.122g/cm3 |
| Boiling Point | 535.8°C at 760 mmHg |
| Refractive Index | 1.54 |
| Flash Point | 277.8°C |
| Vapour Pressur | 1.49E-11mmHg at 25°C |
| MSDS | |