ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
28421-15-0 2,5-dimethoxy-3,6-bis(pentadecylamino)cyclohexa-2,5-diene-1,4-dione |
|
| Chemical Name | 2,5-dimethoxy-3,6-bis(pentadecylamino)cyclohexa-2,5-diene-1,4-dione |
| Molecular Formula | C38H70N2O4 |
| Molecular Weight | 618.9734 |
| InChl | InChI=1/C38H70N2O4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-39-33-35(41)38(44-4)34(36(42)37(33)43-3)40-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h39-40H,5-32H2,1-4H3 |
| CAS Registry Number | 28421-15-0 |
| Molecular Structure | ![]() |
| Density | 0.97g/cm3 |
| Boiling Point | 699.6°C at 760 mmHg |
| Refractive Index | 1.496 |
| Flash Point | 376.9°C |
| Vapour Pressur | 2.02E-19mmHg at 25°C |
| MSDS | |