ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
28573-66-2 2,5-diethoxy-4-(p-tolylthio)benzenediazonium chloride, compound with zinc chloride |
|
| Chemical Name | 2,5-diethoxy-4-(p-tolylthio)benzenediazonium chloride, compound with zinc chloride |
| Synonyms | Benzenediazonium, 2,5-diethoxy-4-((4-methylphenyl)thio)-, chloride, compd. with zinc chloride (ZnCl2) (1:1:?);2,5-Diethoxy-4-(p-tolylthio)benzenediazonium chloride, compound with zinc chloride;Benzenediazonium, 2,5-diethoxy-4-((4-methylphenyl)thio)-, chloride, compd. with zinc chloride (ZnCl2);dichlorozinc; 2,5-diethoxy-4-(p-tolylsulfanyl)benzenediazonium; hydrochloride |
| Molecular Formula | C17H20Cl3N2O2SZn |
| Molecular Weight | 488.1854 |
| InChl | InChI=1/C17H19N2O2S.3ClH.Zn/c1-4-20-15-11-17(16(21-5-2)10-14(15)19-18)22-13-8-6-12(3)7-9-13;;;;/h6-11H,4-5H2,1-3H3;3*1H;/q+1;;;;+2/p-2 |
| CAS Registry Number | 28573-66-2 |
| EINECS | 249-087-9 |
| Molecular Structure | ![]() |
| MSDS | |