ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
30227-50-0 2,4-cyclohexadien-1-one, 6,6'-[1,2-ethanediylbis[imino(Z)methylidyne]]bis-, cobalt salt, (6Z,6'Z)-, compd. with pyridine (1:1:1) |
|
| Chemical Name | 2,4-cyclohexadien-1-one, 6,6'-[1,2-ethanediylbis[imino(Z)methylidyne]]bis-, cobalt salt, (6Z,6'Z)-, compd. with pyridine (1:1:1) |
| Molecular Formula | C21H21CoN3O2 |
| Molecular Weight | 406.3435 |
| InChl | InChI=1/C16H16N2O2.C5H5N.Co/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;1-2-4-6-5-3-1;/h1-8,11-12,17-18H,9-10H2;1-5H;/b13-11-,14-12-;; |
| CAS Registry Number | 30227-50-0 |
| Molecular Structure | ![]() |
| Boiling Point | 498.2°C at 760 mmHg |
| Flash Point | 193.6°C |
| Vapour Pressur | 4.65E-10mmHg at 25°C |
| MSDS | |