ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
32447-71-5 1,5-anhydro-2-deoxy-4-O-alpha-D-glucopyranosyl-D-arabino-hex-1-enitol |
|
| Chemical Name | 1,5-anhydro-2-deoxy-4-O-alpha-D-glucopyranosyl-D-arabino-hex-1-enitol |
| Synonyms | D-arabino-Hex-1-enitol, 1,5-anhydro-2-deoxy-4-O-alpha-D-glucopyranosyl- |
| Molecular Formula | C12H20O9 |
| Molecular Weight | 308.2818 |
| InChl | InChI=1/C12H20O9/c13-3-6-8(16)9(17)10(18)12(20-6)21-11-5(15)1-2-19-7(11)4-14/h1-2,5-18H,3-4H2/t5-,6-,7-,8-,9+,10-,11+,12-/m1/s1 |
| CAS Registry Number | 32447-71-5 |
| Molecular Structure | ![]() |
| Density | 1.61g/cm3 |
| Boiling Point | 612°C at 760 mmHg |
| Refractive Index | 1.626 |
| Flash Point | 323.9°C |
| Vapour Pressur | 1.55E-17mmHg at 25°C |
| MSDS | |