ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33350-19-5 methyl (2-amino-4,7-dioxo-1,4,7,8-tetrahydropteridin-6-yl)acetate |
|
| Chemical Name | methyl (2-amino-4,7-dioxo-1,4,7,8-tetrahydropteridin-6-yl)acetate |
| Molecular Formula | C9H9N5O4 |
| Molecular Weight | 251.1989 |
| InChl | InChI=1/C9H9N5O4/c1-18-4(15)2-3-7(16)12-6-5(11-3)8(17)14-9(10)13-6/h2H2,1H3,(H4,10,12,13,14,16,17) |
| CAS Registry Number | 33350-19-5 |
| Molecular Structure | ![]() |
| Density | 1.87g/cm3 |
| Refractive Index | 1.794 |
| MSDS | |