ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33601-78-4 1-(3-amino-3-oxopropyl)-4-methylpyridinium |
|
| Chemical Name | 1-(3-amino-3-oxopropyl)-4-methylpyridinium |
| Molecular Formula | C9H13N2O |
| Molecular Weight | 165.2118 |
| InChl | InChI=1/C9H12N2O/c1-8-2-5-11(6-3-8)7-4-9(10)12/h2-3,5-6H,4,7H2,1H3,(H-,10,12)/p+1 |
| CAS Registry Number | 33601-78-4 |
| Molecular Structure | ![]() |
| MSDS | |