ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
36398-84-2 N-(2-hydroxyethyl)-N-[(3-methylbicyclo[2.2.1]hept-2-yl)methyl]-4-nitrobenzamide |
|
| Chemical Name | N-(2-hydroxyethyl)-N-[(3-methylbicyclo[2.2.1]hept-2-yl)methyl]-4-nitrobenzamide |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.3942 |
| InChl | InChI=1/C18H24N2O4/c1-12-14-2-3-15(10-14)17(12)11-19(8-9-21)18(22)13-4-6-16(7-5-13)20(23)24/h4-7,12,14-15,17,21H,2-3,8-11H2,1H3 |
| CAS Registry Number | 36398-84-2 |
| Molecular Structure | ![]() |
| Density | 1.222g/cm3 |
| Boiling Point | 537.4°C at 760 mmHg |
| Refractive Index | 1.579 |
| Flash Point | 278.8°C |
| Vapour Pressur | 2.21E-12mmHg at 25°C |
| MSDS | |