ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38556-77-3 2-[1,3-bis(4-methylphenyl)imidazolidin-2-ylidene]-1,3-bis(4-methylphenyl)imidazolidine |
|
| Chemical Name | 2-[1,3-bis(4-methylphenyl)imidazolidin-2-ylidene]-1,3-bis(4-methylphenyl)imidazolidine |
| Molecular Formula | C34H36N4 |
| Molecular Weight | 500.6764 |
| InChl | InChI=1/C34H36N4/c1-25-5-13-29(14-6-25)35-21-22-36(30-15-7-26(2)8-16-30)33(35)34-37(31-17-9-27(3)10-18-31)23-24-38(34)32-19-11-28(4)12-20-32/h5-20H,21-24H2,1-4H3 |
| CAS Registry Number | 38556-77-3 |
| Molecular Structure | ![]() |
| Density | 1.174g/cm3 |
| Boiling Point | 637.6°C at 760 mmHg |
| Refractive Index | 1.655 |
| Flash Point | 268.8°C |
| Vapour Pressur | 3.72E-16mmHg at 25°C |
| MSDS | |