ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42413-23-0 dibenzyl suberate |
|
| Chemical Name | dibenzyl suberate |
| Synonyms | Octanedioic acid, 1,8-bis(phenylmethyl) ester;Dibenzyl suberate;Octanedioic acid, bis(phenylmethyl) ester;dibenzyl octanedioate |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.4394 |
| InChl | InChI=1/C22H26O4/c23-21(25-17-19-11-5-3-6-12-19)15-9-1-2-10-16-22(24)26-18-20-13-7-4-8-14-20/h3-8,11-14H,1-2,9-10,15-18H2 |
| CAS Registry Number | 42413-23-0 |
| EINECS | 255-811-4 |
| Molecular Structure | ![]() |
| Density | 1.1g/cm3 |
| Boiling Point | 472.7°C at 760 mmHg |
| Refractive Index | 1.539 |
| Flash Point | 232°C |
| Vapour Pressur | 4.19E-09mmHg at 25°C |
| MSDS | |