ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53052-82-7 1,1'-(1,1',8,8'-tetrahydroxy-6,6'-dimethyl-2,2'-binaphthalene-7,7'-diyl)diethanone |
|
| Chemical Name | 1,1'-(1,1',8,8'-tetrahydroxy-6,6'-dimethyl-2,2'-binaphthalene-7,7'-diyl)diethanone |
| Synonyms | Ethanone, 1,1'-(1,1',8,8'-tetrahydroxy-6,6'-dimethyl(2,2'-binaphthalene)-7,7'-diyl)bis-;Stypandrol |
| Molecular Formula | C26H22O6 |
| Molecular Weight | 430.4493 |
| InChl | InChI=1/C26H22O6/c1-11-9-15-5-7-17(23(29)21(15)25(31)19(11)13(3)27)18-8-6-16-10-12(2)20(14(4)28)26(32)22(16)24(18)30/h5-10,29-32H,1-4H3 |
| CAS Registry Number | 53052-82-7;99305-33-6 |
| Molecular Structure | ![]() |
| Density | 1.378g/cm3 |
| Boiling Point | 656.3°C at 760 mmHg |
| Refractive Index | 1.723 |
| Flash Point | 364.7°C |
| Vapour Pressur | 7.93E-18mmHg at 25°C |
| MSDS | |