ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5342-23-4 6-methoxy-4-methylquinolin-2(1H)-one |
|
| Chemical Name | 6-methoxy-4-methylquinolin-2(1H)-one |
| Synonyms | 2-quinolinol, 6-methoxy-4-methyl-;6-methoxy-4-methylquinolin-2-ol |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.2105 |
| InChl | InChI=1/C11H11NO2/c1-7-5-11(13)12-10-4-3-8(14-2)6-9(7)10/h3-6H,1-2H3,(H,12,13) |
| CAS Registry Number | 5342-23-4 |
| Molecular Structure | ![]() |
| Density | 1.153g/cm3 |
| Boiling Point | 391.6°C at 760 mmHg |
| Refractive Index | 1.557 |
| Flash Point | 190.7°C |
| Vapour Pressur | 2.43E-06mmHg at 25°C |
| MSDS | |