ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5401-00-3 tris(4-methylpentan-2-yl) propane-1,2,3-tricarboxylate |
|
| Chemical Name | tris(4-methylpentan-2-yl) propane-1,2,3-tricarboxylate |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.6026 |
| InChl | InChI=1/C24H44O6/c1-15(2)10-18(7)28-22(25)13-21(24(27)30-20(9)12-17(5)6)14-23(26)29-19(8)11-16(3)4/h15-21H,10-14H2,1-9H3 |
| CAS Registry Number | 5401-00-3 |
| Molecular Structure | ![]() |
| Density | 0.979g/cm3 |
| Boiling Point | 469.1°C at 760 mmHg |
| Refractive Index | 1.452 |
| Flash Point | 195.1°C |
| Vapour Pressur | 5.68E-09mmHg at 25°C |
| MSDS | |