ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5407-84-1 (1-phenylcyclopentyl)acetonitrile |
|
| Chemical Name | (1-phenylcyclopentyl)acetonitrile |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.2649 |
| InChl | InChI=1/C13H15N/c14-11-10-13(8-4-5-9-13)12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-10H2 |
| CAS Registry Number | 5407-84-1 |
| Molecular Structure | ![]() |
| Density | 1.016g/cm3 |
| Boiling Point | 326.7°C at 760 mmHg |
| Refractive Index | 1.533 |
| Flash Point | 164.5°C |
| Vapour Pressur | 0.000212mmHg at 25°C |
| MSDS | |