ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55291-06-0 N',N'''-(piperazine-1,4-diyldipropane-3,1-diyl)bis[1-(2-methoxyphenyl)urea] |
|
| Chemical Name | N',N'''-(piperazine-1,4-diyldipropane-3,1-diyl)bis[1-(2-methoxyphenyl)urea] |
| Molecular Formula | C26H38N6O4 |
| Molecular Weight | 498.6177 |
| InChl | InChI=1/C26H38N6O4/c1-35-23-11-5-3-9-21(23)29-25(33)27-13-7-15-31-17-19-32(20-18-31)16-8-14-28-26(34)30-22-10-4-6-12-24(22)36-2/h3-6,9-12H,7-8,13-20H2,1-2H3,(H2,27,29,33)(H2,28,30,34) |
| CAS Registry Number | 55291-06-0 |
| Molecular Structure | ![]() |
| Density | 1.194g/cm3 |
| Boiling Point | 642.2°C at 760 mmHg |
| Refractive Index | 1.594 |
| Flash Point | 342.2°C |
| Vapour Pressur | 2.18E-16mmHg at 25°C |
| MSDS | |