ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5770-46-7 6-Butylamino-1,3-dimethyluracil |
|
| Chemical Name | 6-Butylamino-1,3-dimethyluracil |
| Synonyms | 6-(butylamino)-1,3-dimethylpyrimidine-2,4(1H,3H)-dione |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.2609 |
| InChl | InChI=1/C10H17N3O2/c1-4-5-6-11-8-7-9(14)13(3)10(15)12(8)2/h7,11H,4-6H2,1-3H3 |
| CAS Registry Number | 5770-46-7 |
| Molecular Structure | ![]() |
| Density | 1.15g/cm3 |
| Boiling Point | 308.2°C at 760 mmHg |
| Refractive Index | 1.54 |
| Flash Point | 140.2°C |
| Vapour Pressur | 0.000692mmHg at 25°C |
| MSDS | |