ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
60-18-4 L-Tyrosine |
|
| Chemical Name | L-Tyrosine |
| Synonyms | 3-(4-Hydroxyphenyl)-L-alanine;H-Tyr-OH;L-tyrosine,99+% (98% ee/glc);L-tyrosine free base cell culture*tested;L-tyrosine plant cell culture tested;L-Tyrosine, Free Base;tyrosine usp;Tyr;Tyrosine,L- (8CI); (-)-a-Amino-p-hydroxyhydrocinnamicacid; (2S)-2-Amino-3-(4-hydroxyphenyl)propanoic acid;(S)-2-Amino-3-(4-hydroxyphenyl)propanoic acid; (S)-Tyrosine; (S)-a-Amino-4-hydroxybenzenepropanoicacid; 12: PN: US20090069547 PAGE: 10 claimed protein; 50: PN: WO2007067983SEQID: 199 unclaimed protein; 58: PN: US20040014159 SEQID: 33 unclaimedprotein; Benzenepropanoic acid, a-amino-4-hydroxy-, (S)-; L-(-)-Tyrosine; L-Phenylalanine, 4-hydroxy-;L-p-Tyrosine; NSC 82624; NSC 9973; Propanoic acid,2-amino-3-(4-hydroxyphenyl)-, (S)-; Tyrosine; p-Tyrosine |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 |
| InChl | InChI=1/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1 |
| CAS Registry Number | 60-18-4;55520-40-6 |
| EINECS | 200-460-4 |
| Molecular Structure | ![]() |
| Density | 1.34 |
| Melting Point | 290℃ |
| Flash Point | 176℃ |
| Water Solubility | 0.45 g/L (25℃) |
| Hazard Symbols | |
| Risk Codes | R36/37/38:; |
| Safety Description | S26||S36:; |
| MSDS | |